CAS 1155-00-6 appears in our catalog under these names: Dapsone Impurity 18, Bis(2–nitrophenyl) disulfide, Bis(2-nitrophenyl) disulfide, Bis(2-nitrophenyl) Disulfide, >98.0%(GC)(N), Bis(2-nitrophenyl) disulfide, 98%, 98%. Offered by: Chemat Brand, GLPBio, Biosynth, TCI, Chemat. Available pack sizes: on request, 500g, 1000g, 25g, 100g, 1kg.
1-nitro-2-[(2-nitrophenyl)disulfanyl]benzene (CAS 1155-00-6) is a chemical compound with the molecular formula C12H8N2O4S2 and a molecular weight of 308.3 g/mol. IUPAC name: 1-nitro-2-[(2-nitrophenyl)disulfanyl]benzene. InChIKey: NXCKJENHTITELM-UHFFFAOYSA-N.
| Molecular formula | C12H8N2O4S2 |
|---|---|
| Molecular weight | 308.3 g/mol |
| IUPAC name | 1-nitro-2-[(2-nitrophenyl)disulfanyl]benzene |
| InChIKey | NXCKJENHTITELM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)[N+](=O)[O-])SSC2=CC=CC=C2[N+](=O)[O-] |
Computed by PubChem (NCBI)