CAS 537-91-7 appears in our catalog under these names: Bis(3-nitrophenyl) disulfide, 98%, 3-Nitrophenyl disulfide, 3–Nitrophenyl disulfide, Nitrophenide/ 99.43% (existing batch purity), Bis(3-nitrophenyl) Disulfide, >98.0%(HPLC). Offered by: Combi-blocks, Dr. Ehrenstorfer, GLPBio, TargetMol, TCI. Available pack sizes: 1g, 25g, 5g, 250mg, 100g, 5mg, 10mg, 25mg.
1-nitro-3-[(3-nitrophenyl)disulfanyl]benzene (CAS 537-91-7) is a chemical compound with the molecular formula C12H8N2O4S2 and a molecular weight of 308.3 g/mol. IUPAC name: 1-nitro-3-[(3-nitrophenyl)disulfanyl]benzene. InChIKey: ODOFDWDUSSFUMN-UHFFFAOYSA-N.
| Molecular formula | C12H8N2O4S2 |
|---|---|
| Molecular weight | 308.3 g/mol |
| IUPAC name | 1-nitro-3-[(3-nitrophenyl)disulfanyl]benzene |
| InChIKey | ODOFDWDUSSFUMN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)SSC2=CC=CC(=C2)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)