CAS 1155-40-4 appears in our catalog under these names: 2-(4-(4-Hydroxyphenoxy)-3,5-diiodophenyl)acetic acid, 95%, 2-(4-(4-Hydroxyphenoxy)-3,5-diiodophenyl)acetic acid, ≥98%, ≥98%, Levothyroxine Impurity 11, 3,5-Diiodo Thyroacetic Acid, 3,5-Diiodothyroacetic acid, 97%. Offered by: Combi-blocks, Chemat, Chemat Brand, TRC, AmBeed. Available pack sizes: 100mg, 250mg, 1mg, 5mg, 25mg, 50mg, on request, 10mg.
2-[4-(4-hydroxyphenoxy)-3,5-diiodophenyl]acetic acid (CAS 1155-40-4) is a chemical compound with the molecular formula C14H10I2O4 and a molecular weight of 496.03 g/mol. IUPAC name: 2-[4-(4-hydroxyphenoxy)-3,5-diiodophenyl]acetic acid. InChIKey: KKJBNMLZBHFYAE-UHFFFAOYSA-N.
| Molecular formula | C14H10I2O4 |
|---|---|
| Molecular weight | 496.03 g/mol |
| IUPAC name | 2-[4-(4-hydroxyphenoxy)-3,5-diiodophenyl]acetic acid |
| InChIKey | KKJBNMLZBHFYAE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1O)OC2=C(C=C(C=C2I)CC(=O)O)I |
Computed by PubChem (NCBI)