CAS 34043-77-1 appears in our catalog under these names: 3,5-Diiodo-4(4'-methoxyphenoxy)benzoic acid, 95%, 3,5-Diiodo-4(4'-methoxyphenoxy)benzoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 100mg, 1g, 250mg, 500mg, 1000mg.
3,5-diiodo-4-(4-methoxyphenoxy)benzoic acid (CAS 34043-77-1) is a chemical compound with the molecular formula C14H10I2O4 and a molecular weight of 496.03 g/mol. IUPAC name: 3,5-diiodo-4-(4-methoxyphenoxy)benzoic acid. InChIKey: IWPQDTYMEBIDSZ-UHFFFAOYSA-N.
| Molecular formula | C14H10I2O4 |
|---|---|
| Molecular weight | 496.03 g/mol |
| IUPAC name | 3,5-diiodo-4-(4-methoxyphenoxy)benzoic acid |
| InChIKey | IWPQDTYMEBIDSZ-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)OC2=C(C=C(C=C2I)C(=O)O)I |
Computed by PubChem (NCBI)