CAS 115540-65-3 is the registry number for 6–bromobenzo(e)(1,2,3)oxathiazine 2,2–dioxide. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
6-bromo-1,2lambda6,3-benzoxathiazine 2,2-dioxide (CAS 115540-65-3) is a chemical compound with the molecular formula C7H4BrNO3S and a molecular weight of 262.08 g/mol. IUPAC name: 6-bromo-1,2lambda6,3-benzoxathiazine 2,2-dioxide. InChIKey: KFRCHYHGXSBVGV-UHFFFAOYSA-N.
| Molecular formula | C7H4BrNO3S |
|---|---|
| Molecular weight | 262.08 g/mol |
| IUPAC name | 6-bromo-1,2lambda6,3-benzoxathiazine 2,2-dioxide |
| InChIKey | KFRCHYHGXSBVGV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C=NS(=O)(=O)O2 |
Computed by PubChem (NCBI)