CAS 1155408-24-4 is the registry number for methyl 3-fluoro-4-[4-(methoxycarbonyl)phenyl]benzoate, 96%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Methyl 3-fluoro-4-(4-methoxycarbonylphenyl)benzoate (CAS 1155408-24-4) is a chemical compound with the molecular formula C16H13FO4 and a molecular weight of 288.27 g/mol. IUPAC name: methyl 3-fluoro-4-(4-methoxycarbonylphenyl)benzoate. InChIKey: TZEPKOAATCRICF-UHFFFAOYSA-N.
| Molecular formula | C16H13FO4 |
|---|---|
| Molecular weight | 288.27 g/mol |
| IUPAC name | methyl 3-fluoro-4-(4-methoxycarbonylphenyl)benzoate |
| InChIKey | TZEPKOAATCRICF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)C2=C(C=C(C=C2)C(=O)OC)F |
Computed by PubChem (NCBI)