Products 1381944-85-9

CAS 1381944-85-9 is the registry number for Dimethyl 2-fluorobiphenyl-3,3'-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

Methyl 2-fluoro-3-(3-methoxycarbonylphenyl)benzoate (CAS 1381944-85-9) is a chemical compound with the molecular formula C16H13FO4 and a molecular weight of 288.27 g/mol. IUPAC name: methyl 2-fluoro-3-(3-methoxycarbonylphenyl)benzoate. InChIKey: FYZOGABWLDEIDK-UHFFFAOYSA-N.

Identity
Molecular formulaC16H13FO4
Molecular weight288.27 g/mol
IUPAC namemethyl 2-fluoro-3-(3-methoxycarbonylphenyl)benzoate
InChIKeyFYZOGABWLDEIDK-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC=CC(=C1)C2=C(C(=CC=C2)C(=O)OC)F

Computed by PubChem (NCBI)