CAS 1155521-87-1 appears in our catalog under these names: 5-Chloro-6-{(1-(pyridin-3-yl)ethyl)amino}pyridine-3-carboxylic acid, 95%, 5-Chloro-6-{(1-(pyridin-3-yl)ethyl)amino}pyridine-3-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
5-chloro-6-(1-pyridin-3-ylethylamino)pyridine-3-carboxylic acid (CAS 1155521-87-1) is a chemical compound with the molecular formula C13H12ClN3O2 and a molecular weight of 277.70 g/mol. IUPAC name: 5-chloro-6-(1-pyridin-3-ylethylamino)pyridine-3-carboxylic acid. InChIKey: QVOXWLQIZNLKKL-UHFFFAOYSA-N.
| Molecular formula | C13H12ClN3O2 |
|---|---|
| Molecular weight | 277.70 g/mol |
| IUPAC name | 5-chloro-6-(1-pyridin-3-ylethylamino)pyridine-3-carboxylic acid |
| InChIKey | QVOXWLQIZNLKKL-UHFFFAOYSA-N |
| SMILES | CC(C1=CN=CC=C1)NC2=C(C=C(C=N2)C(=O)O)Cl |
Computed by PubChem (NCBI)