Products 1155538-86-5
CAS 1155538-86-5 appears in our catalog under these names: 3-((1,1-Dioxo-1λâ¶-thiomorpholin-4-yl)methyl)benzoic acid, 3-[(1,1-Dioxo-1lambda6-thiomorpholin-4-yl)methyl]benzoic acid, >97%. Offered by: Biosynth, Chemat. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 1g.
3-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]benzoic acid (CAS 1155538-86-5) is a chemical compound with the molecular formula C12H15NO4S and a molecular weight of 269.32 g/mol. IUPAC name: 3-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]benzoic acid. InChIKey: LOOKADNKGOCWJW-UHFFFAOYSA-N.
| Molecular formula | C12H15NO4S |
|---|---|
| Molecular weight | 269.32 g/mol |
| IUPAC name | 3-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]benzoic acid |
| InChIKey | LOOKADNKGOCWJW-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CCN1CC2=CC(=CC=C2)C(=O)O |
Computed by PubChem (NCBI)