CAS 1155588-97-8 is the registry number for 3,5-Dimethyl-1-(3-methylbenzyl)-1H-pyrazole-4-carbaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3,5-dimethyl-1-[(3-methylphenyl)methyl]pyrazole-4-carbaldehyde (CAS 1155588-97-8) is a chemical compound with the molecular formula C14H16N2O and a molecular weight of 228.29 g/mol. IUPAC name: 3,5-dimethyl-1-[(3-methylphenyl)methyl]pyrazole-4-carbaldehyde. InChIKey: RFCXZSRNAJPJJA-UHFFFAOYSA-N.
| Molecular formula | C14H16N2O |
|---|---|
| Molecular weight | 228.29 g/mol |
| IUPAC name | 3,5-dimethyl-1-[(3-methylphenyl)methyl]pyrazole-4-carbaldehyde |
| InChIKey | RFCXZSRNAJPJJA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)CN2C(=C(C(=N2)C)C=O)C |
Computed by PubChem (NCBI)