CAS 115560-96-8 appears in our catalog under these names: 1,2-Benzenedisulfonyl fluoride, 95%, 1,2-BENZENEDISULFONYL FLUORIDE. Offered by: Combi-blocks, Sigma-Aldrich. Available pack sizes: 1g.
Benzene-1,2-disulfonyl fluoride (CAS 115560-96-8) is a chemical compound with the molecular formula C6H4F2O4S2 and a molecular weight of 242.2 g/mol. IUPAC name: benzene-1,2-disulfonyl fluoride. InChIKey: DNXLZBKMVRTNHQ-UHFFFAOYSA-N.
| Molecular formula | C6H4F2O4S2 |
|---|---|
| Molecular weight | 242.2 g/mol |
| IUPAC name | benzene-1,2-disulfonyl fluoride |
| InChIKey | DNXLZBKMVRTNHQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)S(=O)(=O)F)S(=O)(=O)F |
Computed by PubChem (NCBI)