CAS 7552-55-8 appears in our catalog under these names: 1,3-Benzenedisulfonyl fluoride, 95%, Benzene-1,3-disulfonyl fluoride, 1,3-BENZENEDISULFONYL FLUORIDE, 1,3-Benzenedisulfonyl fluoride, 98%, 98%, Benzene-1,3-disulfonyl fluoride, 98%. Offered by: Combi-blocks, Biosynth, Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 2,5g, 10G, 25g, 100mg, 5g.
Benzene-1,3-disulfonyl fluoride (CAS 7552-55-8) is a chemical compound with the molecular formula C6H4F2O4S2 and a molecular weight of 242.2 g/mol. IUPAC name: benzene-1,3-disulfonyl fluoride. InChIKey: VCINFPPPNNZOAD-UHFFFAOYSA-N.
| Molecular formula | C6H4F2O4S2 |
|---|---|
| Molecular weight | 242.2 g/mol |
| IUPAC name | benzene-1,3-disulfonyl fluoride |
| InChIKey | VCINFPPPNNZOAD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)S(=O)(=O)F)S(=O)(=O)F |
Computed by PubChem (NCBI)