CAS 115576-98-2 is the registry number for 5-(Chloromethyl)-1H-benzo[d]imidazol-2(3H)-one, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(chloromethyl)-1,3-dihydrobenzimidazol-2-one (CAS 115576-98-2) is a chemical compound with the molecular formula C8H7ClN2O and a molecular weight of 182.61 g/mol. IUPAC name: 5-(chloromethyl)-1,3-dihydrobenzimidazol-2-one. InChIKey: IQZSACWHKCETMI-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN2O |
|---|---|
| Molecular weight | 182.61 g/mol |
| IUPAC name | 5-(chloromethyl)-1,3-dihydrobenzimidazol-2-one |
| InChIKey | IQZSACWHKCETMI-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1CCl)NC(=O)N2 |
Computed by PubChem (NCBI)