Products 1155910-18-1
CAS 1155910-18-1 appears in our catalog under these names: Methyl 2-bromo-5-(chlorosulfonyl)-4-fluorobenzoate, 95%, Methyl 2-bromo-5-(chlorosulfonyl)-4-fluorobenzoate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
Methyl 2-bromo-5-chlorosulfonyl-4-fluorobenzoate (CAS 1155910-18-1) is a chemical compound with the molecular formula C8H5BrClFO4S and a molecular weight of 331.54 g/mol. IUPAC name: methyl 2-bromo-5-chlorosulfonyl-4-fluorobenzoate. InChIKey: XCQAFMNYQYVXGS-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClFO4S |
|---|---|
| Molecular weight | 331.54 g/mol |
| IUPAC name | methyl 2-bromo-5-chlorosulfonyl-4-fluorobenzoate |
| InChIKey | XCQAFMNYQYVXGS-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1Br)F)S(=O)(=O)Cl |
Computed by PubChem (NCBI)