CAS 1249508-42-6 is the registry number for Methyl 4-bromo-3-(chlorosulfonyl)-5-fluorobenzoate, 95%. Offered by: AmBeed. Available pack sizes: 1g.
Methyl 4-bromo-3-chlorosulfonyl-5-fluorobenzoate (CAS 1249508-42-6) is a chemical compound with the molecular formula C8H5BrClFO4S and a molecular weight of 331.54 g/mol. IUPAC name: methyl 4-bromo-3-chlorosulfonyl-5-fluorobenzoate. InChIKey: URAAFJAHZIQKCN-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClFO4S |
|---|---|
| Molecular weight | 331.54 g/mol |
| IUPAC name | methyl 4-bromo-3-chlorosulfonyl-5-fluorobenzoate |
| InChIKey | URAAFJAHZIQKCN-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C(=C1)S(=O)(=O)Cl)Br)F |
Computed by PubChem (NCBI)