CAS 115611-57-9 appears in our catalog under these names: 1,1,2,2-Tetrafluoroethyl benzyl ether, 95%, ((1,1,2,2-Tetrafluoroethoxy)methyl)benzene, 95%, 1,1,2,2-Tetrafluoroethyl benzyl ether, 98%(GC-MS),RG, 98%(GC-MS),RG. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 25g, 500g, 5g, 100g, 1g.
1,1,2,2-tetrafluoroethoxymethylbenzene (CAS 115611-57-9) is a chemical compound with the molecular formula C9H8F4O and a molecular weight of 208.15 g/mol. IUPAC name: 1,1,2,2-tetrafluoroethoxymethylbenzene. InChIKey: PPSLQKOUGIZCGM-UHFFFAOYSA-N.
| Molecular formula | C9H8F4O |
|---|---|
| Molecular weight | 208.15 g/mol |
| IUPAC name | 1,1,2,2-tetrafluoroethoxymethylbenzene |
| InChIKey | PPSLQKOUGIZCGM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(C(F)F)(F)F |
Computed by PubChem (NCBI)