CAS 1737-11-7 appears in our catalog under these names: 4-(1,1,2,2-Tetrafluoroethoxy)toluene, 98%, 4–(1,1,2,2–Tetrafluoroethoxy)toluene. Offered by: Combi-blocks, GLPBio, Fluorochem, Ambeed. Available pack sizes: 25g, 5g, 100g, 1g, 50g, 500g.
1-methyl-4-(1,1,2,2-tetrafluoroethoxy)benzene (CAS 1737-11-7) is a chemical compound with the molecular formula C9H8F4O and a molecular weight of 208.15 g/mol. IUPAC name: 1-methyl-4-(1,1,2,2-tetrafluoroethoxy)benzene. InChIKey: VACIXOPZIXUAKS-UHFFFAOYSA-N.
| Molecular formula | C9H8F4O |
|---|---|
| Molecular weight | 208.15 g/mol |
| IUPAC name | 1-methyl-4-(1,1,2,2-tetrafluoroethoxy)benzene |
| InChIKey | VACIXOPZIXUAKS-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)OC(C(F)F)(F)F |
Computed by PubChem (NCBI)