Products 1156173-02-2
CAS 1156173-02-2 appears in our catalog under these names: 5-Bromo-2,3-dihydrobenzo(b)thiophen-3-amine, 95%, 5-Bromo-2,3-dihydro-1-benzothiophen-3-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5-bromo-2,3-dihydro-1-benzothiophen-3-amine (CAS 1156173-02-2) is a chemical compound with the molecular formula C8H8BrNS and a molecular weight of 230.13 g/mol. IUPAC name: 5-bromo-2,3-dihydro-1-benzothiophen-3-amine. InChIKey: BXDALXIFCWKWFR-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNS |
|---|---|
| Molecular weight | 230.13 g/mol |
| IUPAC name | 5-bromo-2,3-dihydro-1-benzothiophen-3-amine |
| InChIKey | BXDALXIFCWKWFR-UHFFFAOYSA-N |
| SMILES | C1C(C2=C(S1)C=CC(=C2)Br)N |
Computed by PubChem (NCBI)