CAS 1392072-63-7 is the registry number for 6-Bromo-2,3-dihydrobenzo[b]thiophen-3-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
6-bromo-2,3-dihydro-1-benzothiophen-3-amine (CAS 1392072-63-7) is a chemical compound with the molecular formula C8H8BrNS and a molecular weight of 230.13 g/mol. IUPAC name: 6-bromo-2,3-dihydro-1-benzothiophen-3-amine. InChIKey: OEZKYWIBNFCNNQ-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNS |
|---|---|
| Molecular weight | 230.13 g/mol |
| IUPAC name | 6-bromo-2,3-dihydro-1-benzothiophen-3-amine |
| InChIKey | OEZKYWIBNFCNNQ-UHFFFAOYSA-N |
| SMILES | C1C(C2=C(S1)C=C(C=C2)Br)N |
Computed by PubChem (NCBI)