CAS 1156195-94-6 is the registry number for 7-((2-Methoxyethyl)amino)-6-nitroquinazolin-4(3H)-one, 98%. Offered by: AmBeed. Available pack sizes: 10g, 5g.
7-(2-methoxyethylamino)-6-nitro-3H-quinazolin-4-one (CAS 1156195-94-6) is a chemical compound with the molecular formula C11H12N4O4 and a molecular weight of 264.24 g/mol. IUPAC name: 7-(2-methoxyethylamino)-6-nitro-3H-quinazolin-4-one. InChIKey: PMJWXLFGZLTMEI-UHFFFAOYSA-N.
| Molecular formula | C11H12N4O4 |
|---|---|
| Molecular weight | 264.24 g/mol |
| IUPAC name | 7-(2-methoxyethylamino)-6-nitro-3H-quinazolin-4-one |
| InChIKey | PMJWXLFGZLTMEI-UHFFFAOYSA-N |
| SMILES | COCCNC1=C(C=C2C(=C1)N=CNC2=O)[N+](=O)[O-] |
Computed by PubChem (NCBI)