CAS 684270-44-8 appears in our catalog under these names: Z-L-Dap(N3)-OH*CHA, Z-L-Dap(N3)-OH. Offered by: Creative Peptides, MedChemExpress. Available pack sizes: 1g, 5g, 25g, Get quote.
(2S)-3-azido-2-(phenylmethoxycarbonylamino)propanoic acid (CAS 684270-44-8) is a chemical compound with the molecular formula C11H12N4O4 and a molecular weight of 264.24 g/mol. IUPAC name: (2S)-3-azido-2-(phenylmethoxycarbonylamino)propanoic acid. InChIKey: FQVXTQDGLVUBQZ-VIFPVBQESA-N.
| Molecular formula | C11H12N4O4 |
|---|---|
| Molecular weight | 264.24 g/mol |
| IUPAC name | (2S)-3-azido-2-(phenylmethoxycarbonylamino)propanoic acid |
| InChIKey | FQVXTQDGLVUBQZ-VIFPVBQESA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N[C@@H](CN=[N+]=[N-])C(=O)O |
Computed by PubChem (NCBI)