CAS 1156374-64-9 is the registry number for 4-Fluoro-3-(5-methyl-1H-1,2,3,4-tetrazol-1-yl)aniline. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
4-fluoro-3-(5-methyltetrazol-1-yl)aniline (CAS 1156374-64-9) is a chemical compound with the molecular formula C8H8FN5 and a molecular weight of 193.18 g/mol. IUPAC name: 4-fluoro-3-(5-methyltetrazol-1-yl)aniline. InChIKey: FWEKNWHWVBFMIR-UHFFFAOYSA-N.
| Molecular formula | C8H8FN5 |
|---|---|
| Molecular weight | 193.18 g/mol |
| IUPAC name | 4-fluoro-3-(5-methyltetrazol-1-yl)aniline |
| InChIKey | FWEKNWHWVBFMIR-UHFFFAOYSA-N |
| SMILES | CC1=NN=NN1C2=C(C=CC(=C2)N)F |
Computed by PubChem (NCBI)