CAS 1699418-15-9 appears in our catalog under these names: 1-((5-Fluoropyridin-3-yl)methyl)-1H-1,2,4-triazol-3-amine, 95%, 1-((5-Fluoropyridin-3-yl)methyl)-1H-1,2,4-triazol-3-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
1-[(5-fluoro-3-pyridinyl)methyl]-1,2,4-triazol-3-amine (CAS 1699418-15-9) is a chemical compound with the molecular formula C8H8FN5 and a molecular weight of 193.18 g/mol. IUPAC name: 1-[(5-fluoro-3-pyridinyl)methyl]-1,2,4-triazol-3-amine. InChIKey: HRJCBOPYORWLFY-UHFFFAOYSA-N.
| Molecular formula | C8H8FN5 |
|---|---|
| Molecular weight | 193.18 g/mol |
| IUPAC name | 1-[(5-fluoro-3-pyridinyl)methyl]-1,2,4-triazol-3-amine |
| InChIKey | HRJCBOPYORWLFY-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC=C1F)CN2C=NC(=N2)N |
Computed by PubChem (NCBI)