CAS 1156506-80-7 appears in our catalog under these names: 2,6-Dimethyl-4-(methoxycarbonyl)phenyl Acridine-9-carboxylate, >95% (HPLC), 4-(Methoxycarbonyl)-2,6-dimethylphenyl acridine-9-carboxylate, 97%, 4-(Methoxycarbonyl)-2,6-dimethylphenyl acridine-9-carboxylate, 97%, 97%, (4-METHOXYCARBONYL-2,6-DIMETHYL-PHENYL) ACRIDINE-9-CARBOXYLATE, 97%. Offered by: TRC, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 50mg, 5g, 1g, 100mg, 500mg.
(4-methoxycarbonyl-2,6-dimethylphenyl) acridine-9-carboxylate (CAS 1156506-80-7) is a chemical compound with the molecular formula C24H19NO4 and a molecular weight of 385.4 g/mol. IUPAC name: (4-methoxycarbonyl-2,6-dimethylphenyl) acridine-9-carboxylate. InChIKey: DOUHCXDGBDELMK-UHFFFAOYSA-N.
| Molecular formula | C24H19NO4 |
|---|---|
| Molecular weight | 385.4 g/mol |
| IUPAC name | (4-methoxycarbonyl-2,6-dimethylphenyl) acridine-9-carboxylate |
| InChIKey | DOUHCXDGBDELMK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1OC(=O)C2=C3C=CC=CC3=NC4=CC=CC=C42)C)C(=O)OC |
Computed by PubChem (NCBI)