CAS 97427-71-9 appears in our catalog under these names: 1–Pyrenebutanoic acid, succinimidyl ester, 2,5-Dioxopyrrolidin-1-yl 4-(pyren-1-yl)butanoate, 95%, 95%. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 100mg.
(2,5-dioxopyrrolidin-1-yl) 4-pyren-1-ylbutanoate (CAS 97427-71-9) is a chemical compound with the molecular formula C24H19NO4 and a molecular weight of 385.4 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 4-pyren-1-ylbutanoate. InChIKey: YBNMDCCMCLUHBL-UHFFFAOYSA-N.
| Molecular formula | C24H19NO4 |
|---|---|
| Molecular weight | 385.4 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 4-pyren-1-ylbutanoate |
| InChIKey | YBNMDCCMCLUHBL-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCCC2=C3C=CC4=CC=CC5=C4C3=C(C=C5)C=C2 |
Computed by PubChem (NCBI)