CAS 1156526-28-1 appears in our catalog under these names: N-(5-Amino-2,4-difluorophenyl)propane-1-sulfonamide, 95%, N-(5-Amino-2,4-difluorophenyl)propane-1-sulfonamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,1g, 0,05g, 0,25g, 1g, 0,5g.
N-(5-amino-2,4-difluorophenyl)propane-1-sulfonamide (CAS 1156526-28-1) is a chemical compound with the molecular formula C9H12F2N2O2S and a molecular weight of 250.27 g/mol. IUPAC name: N-(5-amino-2,4-difluorophenyl)propane-1-sulfonamide. InChIKey: KLZYLFPBFHWHBO-UHFFFAOYSA-N.
| Molecular formula | C9H12F2N2O2S |
|---|---|
| Molecular weight | 250.27 g/mol |
| IUPAC name | N-(5-amino-2,4-difluorophenyl)propane-1-sulfonamide |
| InChIKey | KLZYLFPBFHWHBO-UHFFFAOYSA-N |
| SMILES | CCCS(=O)(=O)NC1=C(C=C(C(=C1)N)F)F |
Computed by PubChem (NCBI)