CAS 24933-35-5 appears in our catalog under these names: 4-Difluoromethanesulfonyl-1-N-ethylbenzene-1,2-diamine, 95%, 4-Difluoromethanesulfonyl-1-N-ethylbenzene-1,2-diamine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
4-(difluoromethylsulfonyl)-1-N-ethylbenzene-1,2-diamine (CAS 24933-35-5) is a chemical compound with the molecular formula C9H12F2N2O2S and a molecular weight of 250.27 g/mol. IUPAC name: 4-(difluoromethylsulfonyl)-1-N-ethylbenzene-1,2-diamine. InChIKey: IQODVBKYKUMBNJ-UHFFFAOYSA-N.
| Molecular formula | C9H12F2N2O2S |
|---|---|
| Molecular weight | 250.27 g/mol |
| IUPAC name | 4-(difluoromethylsulfonyl)-1-N-ethylbenzene-1,2-diamine |
| InChIKey | IQODVBKYKUMBNJ-UHFFFAOYSA-N |
| SMILES | CCNC1=C(C=C(C=C1)S(=O)(=O)C(F)F)N |
Computed by PubChem (NCBI)