Products 1156594-78-3

CAS 1156594-78-3 is the registry number for 5-{((2-Methoxyethyl)sulfanyl)methyl}furan-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

5-(2-methoxyethylsulfanylmethyl)furan-2-carboxylic acid (CAS 1156594-78-3) is a chemical compound with the molecular formula C9H12O4S and a molecular weight of 216.26 g/mol. IUPAC name: 5-(2-methoxyethylsulfanylmethyl)furan-2-carboxylic acid. InChIKey: CSZFYCMBDKCSGG-UHFFFAOYSA-N.

Identity
Molecular formulaC9H12O4S
Molecular weight216.26 g/mol
IUPAC name5-(2-methoxyethylsulfanylmethyl)furan-2-carboxylic acid
InChIKeyCSZFYCMBDKCSGG-UHFFFAOYSA-N
SMILESCOCCSCC1=CC=C(O1)C(=O)O

Computed by PubChem (NCBI)