Products 1823232-10-5

CAS 1823232-10-5 is the registry number for 2-Ethoxy-4-methylbenzenesulfonic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-ethoxy-4-methylbenzenesulfonic acid (CAS 1823232-10-5) is a chemical compound with the molecular formula C9H12O4S and a molecular weight of 216.26 g/mol. IUPAC name: 2-ethoxy-4-methylbenzenesulfonic acid. InChIKey: KYPXGHLQWSWYBR-UHFFFAOYSA-N.

Identity
Molecular formulaC9H12O4S
Molecular weight216.26 g/mol
IUPAC name2-ethoxy-4-methylbenzenesulfonic acid
InChIKeyKYPXGHLQWSWYBR-UHFFFAOYSA-N
SMILESCCOC1=C(C=CC(=C1)C)S(=O)(=O)O

Computed by PubChem (NCBI)