CAS 1156853-52-9 appears in our catalog under these names: 1-(4-Bromo-2-fluorophenyl)-4,4-dimethylpentan-3-one, 95%, 1-(4-Bromo-2-fluorophenyl)-4,4-dimethylpentan-3-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
1-(4-bromo-2-fluorophenyl)-4,4-dimethylpentan-3-one (CAS 1156853-52-9) is a chemical compound with the molecular formula C13H16BrFO and a molecular weight of 287.17 g/mol. IUPAC name: 1-(4-bromo-2-fluorophenyl)-4,4-dimethylpentan-3-one. InChIKey: FVAJTNSLFJMZDQ-UHFFFAOYSA-N.
| Molecular formula | C13H16BrFO |
|---|---|
| Molecular weight | 287.17 g/mol |
| IUPAC name | 1-(4-bromo-2-fluorophenyl)-4,4-dimethylpentan-3-one |
| InChIKey | FVAJTNSLFJMZDQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)CCC1=C(C=C(C=C1)Br)F |
Computed by PubChem (NCBI)