Products 1318910-35-8
CAS 1318910-35-8 is the registry number for (5-bromo-2-fluorophenyl)(cyclohexyl)methanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(5-bromo-2-fluorophenyl)-cyclohexylmethanol (CAS 1318910-35-8) is a chemical compound with the molecular formula C13H16BrFO and a molecular weight of 287.17 g/mol. IUPAC name: (5-bromo-2-fluorophenyl)-cyclohexylmethanol. InChIKey: VXCNWCXZLJCEFI-UHFFFAOYSA-N.
| Molecular formula | C13H16BrFO |
|---|---|
| Molecular weight | 287.17 g/mol |
| IUPAC name | (5-bromo-2-fluorophenyl)-cyclohexylmethanol |
| InChIKey | VXCNWCXZLJCEFI-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)C(C2=C(C=CC(=C2)Br)F)O |
Computed by PubChem (NCBI)