Products 1156860-57-9

CAS 1156860-57-9 is the registry number for 1,1-Bis(4-bromophenyl)-N-methylmethanamine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

1,1-bis(4-bromophenyl)-N-methylmethanamine (CAS 1156860-57-9) is a chemical compound with the molecular formula C14H13Br2N and a molecular weight of 355.07 g/mol. IUPAC name: 1,1-bis(4-bromophenyl)-N-methylmethanamine. InChIKey: ARLRVXKOPPYPHE-UHFFFAOYSA-N.

Identity
Molecular formulaC14H13Br2N
Molecular weight355.07 g/mol
IUPAC name1,1-bis(4-bromophenyl)-N-methylmethanamine
InChIKeyARLRVXKOPPYPHE-UHFFFAOYSA-N
SMILESCNC(C1=CC=C(C=C1)Br)C2=CC=C(C=C2)Br

Computed by PubChem (NCBI)