CAS 2243410-21-9 is the registry number for 1,1-Bis(3-bromophenyl)-N-methylmethanamine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g.
1,1-bis(3-bromophenyl)-N-methylmethanamine (CAS 2243410-21-9) is a chemical compound with the molecular formula C14H13Br2N and a molecular weight of 355.07 g/mol. IUPAC name: 1,1-bis(3-bromophenyl)-N-methylmethanamine. InChIKey: SMUVDJBEJQDRGB-UHFFFAOYSA-N.
| Molecular formula | C14H13Br2N |
|---|---|
| Molecular weight | 355.07 g/mol |
| IUPAC name | 1,1-bis(3-bromophenyl)-N-methylmethanamine |
| InChIKey | SMUVDJBEJQDRGB-UHFFFAOYSA-N |
| SMILES | CNC(C1=CC(=CC=C1)Br)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)