Products 1156868-60-8
CAS 1156868-60-8 appears in our catalog under these names: 3-((2-Aminophenyl)formamido)propanamide, 95%, 3-((2-Aminophenyl)formamido)propanamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
2-amino-N-(3-amino-3-oxopropyl)benzamide (CAS 1156868-60-8) is a chemical compound with the molecular formula C10H13N3O2 and a molecular weight of 207.23 g/mol. IUPAC name: 2-amino-N-(3-amino-3-oxopropyl)benzamide. InChIKey: VWZCXPFSTNJUPC-UHFFFAOYSA-N.
| Molecular formula | C10H13N3O2 |
|---|---|
| Molecular weight | 207.23 g/mol |
| IUPAC name | 2-amino-N-(3-amino-3-oxopropyl)benzamide |
| InChIKey | VWZCXPFSTNJUPC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)NCCC(=O)N)N |
Computed by PubChem (NCBI)