Products 1156916-39-0
CAS 1156916-39-0 is the registry number for 3,5-Dimethyl-1-(3-methylphenyl)-1h-pyrazole-4-sulfonyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg.
3,5-dimethyl-1-(3-methylphenyl)pyrazole-4-sulfonyl chloride (CAS 1156916-39-0) is a chemical compound with the molecular formula C12H13ClN2O2S and a molecular weight of 284.76 g/mol. IUPAC name: 3,5-dimethyl-1-(3-methylphenyl)pyrazole-4-sulfonyl chloride. InChIKey: VYGHDWZYVZMBAK-UHFFFAOYSA-N.
| Molecular formula | C12H13ClN2O2S |
|---|---|
| Molecular weight | 284.76 g/mol |
| IUPAC name | 3,5-dimethyl-1-(3-methylphenyl)pyrazole-4-sulfonyl chloride |
| InChIKey | VYGHDWZYVZMBAK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)N2C(=C(C(=N2)C)S(=O)(=O)Cl)C |
Computed by PubChem (NCBI)