CAS 1235440-80-8 appears in our catalog under these names: Methyl 3-((2-amino-1,3-thiazol-5-yl)methyl)benzoate hydrochloride, 95%, Methyl 3-((2-amino-1,3-thiazol-5-yl)methyl)benzoate hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
Methyl 3-[(2-amino-1,3-thiazol-5-yl)methyl]benzoate;hydrochloride (CAS 1235440-80-8) is a chemical compound with the molecular formula C12H13ClN2O2S and a molecular weight of 284.76 g/mol. IUPAC name: methyl 3-[(2-amino-1,3-thiazol-5-yl)methyl]benzoate;hydrochloride. InChIKey: RRNSYZKCYAQTLJ-UHFFFAOYSA-N.
| Molecular formula | C12H13ClN2O2S |
|---|---|
| Molecular weight | 284.76 g/mol |
| IUPAC name | methyl 3-[(2-amino-1,3-thiazol-5-yl)methyl]benzoate;hydrochloride |
| InChIKey | RRNSYZKCYAQTLJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=CC(=C1)CC2=CN=C(S2)N.Cl |
Computed by PubChem (NCBI)