CAS 1156926-83-8 is the registry number for N-(3-(1-Methylethyl)phenyl)-2-propenamide. Offered by: Biosynth. Available pack sizes: 250mg, 100mg, 500mg, 1000mg.
N-(3-propan-2-ylphenyl)prop-2-enamide (CAS 1156926-83-8) is a chemical compound with the molecular formula C12H15NO and a molecular weight of 189.25 g/mol. IUPAC name: N-(3-propan-2-ylphenyl)prop-2-enamide. InChIKey: TXSKZKNZFGWLKA-UHFFFAOYSA-N.
| Molecular formula | C12H15NO |
|---|---|
| Molecular weight | 189.25 g/mol |
| IUPAC name | N-(3-propan-2-ylphenyl)prop-2-enamide |
| InChIKey | TXSKZKNZFGWLKA-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=CC=C1)NC(=O)C=C |
Computed by PubChem (NCBI)