CAS 1157-84-2 appears in our catalog under these names: Benzaldehyd-2,4-dinitrophenylhydrazone, Benzaldehyde–2,4–dinitrophenylhydrazone environmental standard, 99%, Benzaldehyde 2,4-Dinitrophenylhydrazone, >98.0%(T), BENZALDEHYDE-DNPH, 1X1ML, 100UG/ML, &, Benzaldehyde-2,4-dinitrophenylhydrazone, 98%, 98%. Offered by: Dr. Ehrenstorfer, GLPBio, TCI, Sigma-Aldrich, Chemat. Available pack sizes: 100mg, 1g, 10g, 1EA, 250mg, 500mg, 1x100mg, 1x5ml.
N-[(E)-benzylideneamino]-2,4-dinitroaniline (CAS 1157-84-2) is a chemical compound with the molecular formula C13H10N4O4 and a molecular weight of 286.24 g/mol. IUPAC name: N-[(E)-benzylideneamino]-2,4-dinitroaniline. InChIKey: DZPRPFUXOZTWAJ-NTEUORMPSA-N.
| Molecular formula | C13H10N4O4 |
|---|---|
| Molecular weight | 286.24 g/mol |
| IUPAC name | N-[(E)-benzylideneamino]-2,4-dinitroaniline |
| InChIKey | DZPRPFUXOZTWAJ-NTEUORMPSA-N |
| SMILES | C1=CC=C(C=C1)/C=N/NC2=C(C=C(C=C2)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)