CAS 1157112-82-7 is the registry number for 4-((2-Bromophenoxy)methyl)-5-chloro-1,2,3-thiadiazole, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[(2-bromophenoxy)methyl]-5-chlorothiadiazole (CAS 1157112-82-7) is a chemical compound with the molecular formula C9H6BrClN2OS and a molecular weight of 305.58 g/mol. IUPAC name: 4-[(2-bromophenoxy)methyl]-5-chlorothiadiazole. InChIKey: OESAFRNQDDEVRW-UHFFFAOYSA-N.
| Molecular formula | C9H6BrClN2OS |
|---|---|
| Molecular weight | 305.58 g/mol |
| IUPAC name | 4-[(2-bromophenoxy)methyl]-5-chlorothiadiazole |
| InChIKey | OESAFRNQDDEVRW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)OCC2=C(SN=N2)Cl)Br |
Computed by PubChem (NCBI)