CAS 727718-13-0 appears in our catalog under these names: N-(2-Bromo-4-(cyanosulfanyl)phenyl)-2-chloroacetamide, 95%, N-(2-Bromo-4-(cyanosulfanyl)phenyl)-2-chloroacetamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
[3-bromo-4-[(2-chloroacetyl)amino]phenyl] thiocyanate (CAS 727718-13-0) is a chemical compound with the molecular formula C9H6BrClN2OS and a molecular weight of 305.58 g/mol. IUPAC name: [3-bromo-4-[(2-chloroacetyl)amino]phenyl] thiocyanate. InChIKey: SWJHLOZLWIGZAA-UHFFFAOYSA-N.
| Molecular formula | C9H6BrClN2OS |
|---|---|
| Molecular weight | 305.58 g/mol |
| IUPAC name | [3-bromo-4-[(2-chloroacetyl)amino]phenyl] thiocyanate |
| InChIKey | SWJHLOZLWIGZAA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1SC#N)Br)NC(=O)CCl |
Computed by PubChem (NCBI)