Products 115712-88-4
CAS 115712-88-4 appears in our catalog under these names: Adonifoline, (+)-Adonifoline. Offered by: Chemat Brand, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: on request, 5g, 10mg, 5mg, 25mg, 50mg, 250mg, 1g.
(1R,20R)-4-hydroxy-5,10-dimethyl-2,6,9,12-tetraoxa-17-azapentacyclo[12.5.1.14,8.08,10.017,20]henicos-14-ene-3,11-dione (CAS 115712-88-4) is a chemical compound with the molecular formula C18H23NO7 and a molecular weight of 365.4 g/mol. IUPAC name: (1R,20R)-4-hydroxy-5,10-dimethyl-2,6,9,12-tetraoxa-17-azapentacyclo[12.5.1.14,8.08,10.017,20]henicos-14-ene-3,11-dione. InChIKey: MYOFCWPLRKBPJD-AQYQBICXSA-N.
| Molecular formula | C18H23NO7 |
|---|---|
| Molecular weight | 365.4 g/mol |
| IUPAC name | (1R,20R)-4-hydroxy-5,10-dimethyl-2,6,9,12-tetraoxa-17-azapentacyclo[12.5.1.14,8.08,10.017,20]henicos-14-ene-3,11-dione |
| InChIKey | MYOFCWPLRKBPJD-AQYQBICXSA-N |
| SMILES | CC1C2(CC3(CO1)C(O3)(C(=O)OCC4=CCN5[C@H]4[C@@H](CC5)OC2=O)C)O |
Computed by PubChem (NCBI)