Products 168154-47-0

CAS 168154-47-0 is the registry number for Diethyl 2–acetamido–2–(2–(3–methoxyphenyl)–2–oxoethyl)malonate. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.

Structural formula: {0} (CAS {1})

Diethyl 2-acetamido-2-[2-(3-methoxyphenyl)-2-oxoethyl]propanedioate (CAS 168154-47-0) is a chemical compound with the molecular formula C18H23NO7 and a molecular weight of 365.4 g/mol. IUPAC name: diethyl 2-acetamido-2-[2-(3-methoxyphenyl)-2-oxoethyl]propanedioate. InChIKey: PZULEKIYLSMERE-UHFFFAOYSA-N.

Identity
Molecular formulaC18H23NO7
Molecular weight365.4 g/mol
IUPAC namediethyl 2-acetamido-2-[2-(3-methoxyphenyl)-2-oxoethyl]propanedioate
InChIKeyPZULEKIYLSMERE-UHFFFAOYSA-N
SMILESCCOC(=O)C(CC(=O)C1=CC(=CC=C1)OC)(C(=O)OCC)NC(=O)C

Computed by PubChem (NCBI)