CAS 1157457-17-4 is the registry number for N-(5-Bromo-2-methylphenyl)-3-cyanobenzamide, 95%. Offered by: AmBeed. Available pack sizes: 250mg, 100mg.
N-(5-bromo-2-methylphenyl)-3-cyanobenzamide (CAS 1157457-17-4) is a chemical compound with the molecular formula C15H11BrN2O and a molecular weight of 315.16 g/mol. IUPAC name: N-(5-bromo-2-methylphenyl)-3-cyanobenzamide. InChIKey: VPXLEUZUEFZJTF-UHFFFAOYSA-N.
| Molecular formula | C15H11BrN2O |
|---|---|
| Molecular weight | 315.16 g/mol |
| IUPAC name | N-(5-bromo-2-methylphenyl)-3-cyanobenzamide |
| InChIKey | VPXLEUZUEFZJTF-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)Br)NC(=O)C2=CC=CC(=C2)C#N |
Computed by PubChem (NCBI)