CAS 1157504-04-5 is the registry number for 6-N-Ethylquinoline-5,6-diamine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
6-N-ethylquinoline-5,6-diamine (CAS 1157504-04-5) is a chemical compound with the molecular formula C11H13N3 and a molecular weight of 187.24 g/mol. IUPAC name: 6-N-ethylquinoline-5,6-diamine. InChIKey: WGKVAMDURIFSKA-UHFFFAOYSA-N.
| Molecular formula | C11H13N3 |
|---|---|
| Molecular weight | 187.24 g/mol |
| IUPAC name | 6-N-ethylquinoline-5,6-diamine |
| InChIKey | WGKVAMDURIFSKA-UHFFFAOYSA-N |
| SMILES | CCNC1=C(C2=C(C=C1)N=CC=C2)N |
Computed by PubChem (NCBI)