CAS 1158098-77-1 is the registry number for 3-Boc-amino-3-(4-cyanophenyl)oxetane, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 10g, 1g, 5g, 100mg.
Tert-butyl N-[3-(4-cyanophenyl)oxetan-3-yl]carbamate (CAS 1158098-77-1) is a chemical compound with the molecular formula C15H18N2O3 and a molecular weight of 274.31 g/mol. IUPAC name: tert-butyl N-[3-(4-cyanophenyl)oxetan-3-yl]carbamate. InChIKey: ZGGQPIIEGFSXAB-UHFFFAOYSA-N.
| Molecular formula | C15H18N2O3 |
|---|---|
| Molecular weight | 274.31 g/mol |
| IUPAC name | tert-butyl N-[3-(4-cyanophenyl)oxetan-3-yl]carbamate |
| InChIKey | ZGGQPIIEGFSXAB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1(COC1)C2=CC=C(C=C2)C#N |
Computed by PubChem (NCBI)