Products 2270910-43-3

CAS 2270910-43-3 is the registry number for 4-(4-Hydroxy-pyrazol-1-ylmethyl)-benzoic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Tert-butyl 4-[(4-hydroxypyrazol-1-yl)methyl]benzoate (CAS 2270910-43-3) is a chemical compound with the molecular formula C15H18N2O3 and a molecular weight of 274.31 g/mol. IUPAC name: tert-butyl 4-[(4-hydroxypyrazol-1-yl)methyl]benzoate. InChIKey: FDPBZTIOAOYAAJ-UHFFFAOYSA-N.

Identity
Molecular formulaC15H18N2O3
Molecular weight274.31 g/mol
IUPAC nametert-butyl 4-[(4-hydroxypyrazol-1-yl)methyl]benzoate
InChIKeyFDPBZTIOAOYAAJ-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)C1=CC=C(C=C1)CN2C=C(C=N2)O

Computed by PubChem (NCBI)