CAS 1158208-47-9 is the registry number for 5-Chloro-1-benzothiophene-3-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 100mg, 50mg, 250mg, 1000mg, 500mg.
5-chloro-1-benzothiophene-3-sulfonyl chloride (CAS 1158208-47-9) is a chemical compound with the molecular formula C8H4Cl2O2S2 and a molecular weight of 267.2 g/mol. IUPAC name: 5-chloro-1-benzothiophene-3-sulfonyl chloride. InChIKey: OCOLHKPAUQGRME-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2O2S2 |
|---|---|
| Molecular weight | 267.2 g/mol |
| IUPAC name | 5-chloro-1-benzothiophene-3-sulfonyl chloride |
| InChIKey | OCOLHKPAUQGRME-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)C(=CS2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)