Products 1158208-47-9

CAS 1158208-47-9 is the registry number for 5-Chloro-1-benzothiophene-3-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 100mg, 50mg, 250mg, 1000mg, 500mg.

Structural formula: {0} (CAS {1})

5-chloro-1-benzothiophene-3-sulfonyl chloride (CAS 1158208-47-9) is a chemical compound with the molecular formula C8H4Cl2O2S2 and a molecular weight of 267.2 g/mol. IUPAC name: 5-chloro-1-benzothiophene-3-sulfonyl chloride. InChIKey: OCOLHKPAUQGRME-UHFFFAOYSA-N.

Identity
Molecular formulaC8H4Cl2O2S2
Molecular weight267.2 g/mol
IUPAC name5-chloro-1-benzothiophene-3-sulfonyl chloride
InChIKeyOCOLHKPAUQGRME-UHFFFAOYSA-N
SMILESC1=CC2=C(C=C1Cl)C(=CS2)S(=O)(=O)Cl

Computed by PubChem (NCBI)