CAS 128851-98-9 appears in our catalog under these names: 5-Chlorobenzo(b)thiophene-2-sulfonyl chloride, 97%, 5-Chloro-1-benzothiophene-2-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5-chloro-1-benzothiophene-2-sulfonyl chloride (CAS 128851-98-9) is a chemical compound with the molecular formula C8H4Cl2O2S2 and a molecular weight of 267.2 g/mol. IUPAC name: 5-chloro-1-benzothiophene-2-sulfonyl chloride. InChIKey: BABMIQVTGOYKAZ-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2O2S2 |
|---|---|
| Molecular weight | 267.2 g/mol |
| IUPAC name | 5-chloro-1-benzothiophene-2-sulfonyl chloride |
| InChIKey | BABMIQVTGOYKAZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)C=C(S2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)