Products 1158269-66-9

CAS 1158269-66-9 is the registry number for 1-Methyl-n-(pyridin-3-ylmethyl)piperidin-4-amine, oxalic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.

Structural formula: {0} (CAS {1})

1-methyl-N-(pyridin-3-ylmethyl)piperidin-4-amine;oxalic acid (CAS 1158269-66-9) is a chemical compound with the molecular formula C14H21N3O4 and a molecular weight of 295.33 g/mol. IUPAC name: 1-methyl-N-(pyridin-3-ylmethyl)piperidin-4-amine;oxalic acid. InChIKey: CXZDMNYRNNICFO-UHFFFAOYSA-N.

Identity
Molecular formulaC14H21N3O4
Molecular weight295.33 g/mol
IUPAC name1-methyl-N-(pyridin-3-ylmethyl)piperidin-4-amine;oxalic acid
InChIKeyCXZDMNYRNNICFO-UHFFFAOYSA-N
SMILESCN1CCC(CC1)NCC2=CN=CC=C2.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)