CAS 1359655-89-2 appears in our catalog under these names: 7-tert-Butyl 1-methyl 3-methyl-5h,6h,7h,8h-imidazo[1,5-a]pyrazine-1,7-dicarboxylate, 95%, 7-Tert-butyl 1-methyl 3-methyl-5H,6H,7H,8H-imidazo(1,5-a)pyrazine-1,7-dicarboxylate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 10g.
7-O-tert-butyl 1-O-methyl 3-methyl-6,8-dihydro-5H-imidazo[1,5-a]pyrazine-1,7-dicarboxylate (CAS 1359655-89-2) is a chemical compound with the molecular formula C14H21N3O4 and a molecular weight of 295.33 g/mol. IUPAC name: 7-O-tert-butyl 1-O-methyl 3-methyl-6,8-dihydro-5H-imidazo[1,5-a]pyrazine-1,7-dicarboxylate. InChIKey: XGEPMUMXVHGMTI-UHFFFAOYSA-N.
| Molecular formula | C14H21N3O4 |
|---|---|
| Molecular weight | 295.33 g/mol |
| IUPAC name | 7-O-tert-butyl 1-O-methyl 3-methyl-6,8-dihydro-5H-imidazo[1,5-a]pyrazine-1,7-dicarboxylate |
| InChIKey | XGEPMUMXVHGMTI-UHFFFAOYSA-N |
| SMILES | CC1=NC(=C2N1CCN(C2)C(=O)OC(C)(C)C)C(=O)OC |
Computed by PubChem (NCBI)